C9H19N3O2 — CID 88560908
(2R)-2,3-diamino-N-[(2R)-1-oxohexan-2-yl]propanamide (PubChem CID 88560908) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is (2R)-2,3-diamino-N-[(2R)-1-oxohexan-2-yl]propanamide.
| Compound Name | (2R)-2,3-diamino-N-[(2R)-1-oxohexan-2-yl]propanamide |
|---|---|
| PubChem CID | 88560908 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (2R)-2,3-diamino-N-[(2R)-1-oxohexan-2-yl]propanamide |
| SMILES | CCCC[C@H](C=O)NC(=O)[C@H](N)CN |
| InChI | InChI=1S/C9H19N3O2/c1-2-3-4-7(6-13)12-9(14)8(11)5-10/h6-8H,2-5,10-11H2,1H3,(H,12,14)/t7-,8-/m1/s1 |
| InChIKey | IXCXAAMCGOCVDT-HTQZYQBOSA-N |
| XLogP | -0.85 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|