C9H17N3O4 — CID 123919208
3-amino-4-[(5-amino-1-oxopentan-2-yl)amino]-4-oxobutanoic acid (PubChem CID 123919208) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-amino-4-[(5-amino-1-oxopentan-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[(5-amino-1-oxopentan-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123919208 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-amino-4-[(5-amino-1-oxopentan-2-yl)amino]-4-oxobutanoic acid |
| SMILES | NCCCC(C=O)NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C9H17N3O4/c10-3-1-2-6(5-13)12-9(16)7(11)4-8(14)15/h5-7H,1-4,10-11H2,(H,12,16)(H,14,15) |
| InChIKey | IXJPNVIRLYJCFP-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|