C20H38N10O6 — CID 54136273
(2S)-2-amino-N-[(2S)-4-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1,4-dioxobutan-2-yl]butanediamide (PubChem CID 54136273) has the molecular formula C20H38N10O6 and a molecular weight of 514.59 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-4-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1,4-dioxobutan-2-yl]butanediamide.
| Compound Name | (2S)-2-amino-N-[(2S)-4-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1,4-dioxobutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 54136273 |
| Molecular Formula | C20H38N10O6 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-4-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1,4-dioxobutan-2-yl]butanediamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CC(N)=O)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C20H38N10O6/c21-6-2-1-5-13(18(35)28-11(10-31)4-3-7-27-20(25)26)29-19(36)14(9-16(24)33)30-17(34)12(22)8-15(23)32/h10-14H,1-9,21-22H2,(H2,23,32)(H2,24,33)(H,28,35)(H,29,36)(H,30,34)(H4,25,26,27)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | SHDVXODPKOJMND-XUXIUFHCSA-N |
| XLogP | -5.10 |
| TPSA | 306.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | -5.10 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|