C17H34N10O4 — CID 173162221
(2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanediamide (PubChem CID 173162221) has the molecular formula C17H34N10O4 and a molecular weight of 442.53 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanediamide.
| Compound Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 173162221 |
| Molecular Formula | C17H34N10O4 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanediamide |
| SMILES | NC(=O)CC[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C17H34N10O4/c18-11(5-6-13(19)29)14(30)27-12(4-2-8-25-17(22)23)15(31)26-10(9-28)3-1-7-24-16(20)21/h9-12H,1-8,18H2,(H2,19,29)(H,26,31)(H,27,30)(H4,20,21,24)(H4,22,23,25)/t10-,11-,12-/m0/s1 |
| InChIKey | NTBJFKZKQRMMHV-SRVKXCTJSA-N |
| XLogP | -4.15 |
| TPSA | 273.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|