C17H34N8O4 — CID 173087350
(2S)-2-amino-N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide (PubChem CID 173087350) has the molecular formula C17H34N8O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide.
| Compound Name | (2S)-2-amino-N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 173087350 |
| Molecular Formula | C17H34N8O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCC(N)=O)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C17H34N8O4/c18-8-2-1-5-13(25-15(28)12(19)6-7-14(20)27)16(29)24-11(10-26)4-3-9-23-17(21)22/h10-13H,1-9,18-19H2,(H2,20,27)(H,24,29)(H,25,28)(H4,21,22,23)/t11-,12-,13-/m0/s1 |
| InChIKey | MBHJTDQLGVAJIR-AVGNSLFASA-N |
| XLogP | -3.07 |
| TPSA | 234.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|