C18H38N12O3 — CID 173062657
(2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanamide (PubChem CID 173062657) has the molecular formula C18H38N12O3 and a molecular weight of 470.58 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 173062657 |
| Molecular Formula | C18H38N12O3 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]pentanamide |
| SMILES | NC(N)=NCCC[C@@H](C=O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C18H38N12O3/c19-12(5-2-8-27-17(22)23)14(32)30-13(6-3-9-28-18(24)25)15(33)29-11(10-31)4-1-7-26-16(20)21/h10-13H,1-9,19H2,(H,29,33)(H,30,32)(H4,20,21,26)(H4,22,23,27)(H4,24,25,28)/t11-,12-,13-/m0/s1 |
| InChIKey | MZUCJVARUOFMJO-AVGNSLFASA-N |
| XLogP | -4.36 |
| TPSA | 294.49 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|