C18H36N6O3 — CID 123977386
(2R)-2-amino-N-[(2R)-1-[deuterio-[(2R)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]hexanamide (PubChem CID 123977386) has the molecular formula C18H36N6O3 and a molecular weight of 385.53 g/mol. Its IUPAC name is (2R)-2-amino-N-[(2R)-1-[deuterio-[(2R)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2R)-2-amino-N-[(2R)-1-[deuterio-[(2R)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 123977386 |
| Molecular Formula | C18H36N6O3 |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.29 |
| IUPAC Name | (2R)-2-amino-N-[(2R)-1-[deuterio-[(2R)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]hexanamide |
| SMILES | [2H]N(C(=O)[C@@H](CCCC)NC(=O)[C@H](N)CCCC)[C@@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C18H36N6O3/c1-3-5-9-14(19)16(26)24-15(10-6-4-2)17(27)23-13(12-25)8-7-11-22-18(20)21/h12-15H,3-11,19H2,1-2H3,(H,23,27)(H,24,26)(H4,20,21,22)/t13-,14-,15-/m1/s1/i/hD |
| InChIKey | SAJRWSZDVKPFPQ-NRKOQYDCSA-N |
| XLogP | -0.08 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|