C14H29N5O3 — CID 169185476
2,6-diamino-N-[2-[(6-amino-1-oxohexan-2-yl)amino]-2-oxoethyl]hexanamide (PubChem CID 169185476) has the molecular formula C14H29N5O3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2,6-diamino-N-[2-[(6-amino-1-oxohexan-2-yl)amino]-2-oxoethyl]hexanamide.
| Compound Name | 2,6-diamino-N-[2-[(6-amino-1-oxohexan-2-yl)amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 169185476 |
| Molecular Formula | C14H29N5O3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2,6-diamino-N-[2-[(6-amino-1-oxohexan-2-yl)amino]-2-oxoethyl]hexanamide |
| SMILES | NCCCCC(C=O)NC(=O)CNC(=O)C(N)CCCCN |
| InChI | InChI=1S/C14H29N5O3/c15-7-3-1-5-11(10-20)19-13(21)9-18-14(22)12(17)6-2-4-8-16/h10-12H,1-9,15-17H2,(H,18,22)(H,19,21) |
| InChIKey | AFKJBNRLRDVIFP-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|