C11H21N3O4 — CID 54125890
(4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid (PubChem CID 54125890) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54125890 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | (4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)N[C@H](C=O)CCC(=O)O |
| InChI | InChI=1S/C11H21N3O4/c12-6-2-1-3-9(13)11(18)14-8(7-15)4-5-10(16)17/h7-9H,1-6,12-13H2,(H,14,18)(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | CBEDKYAKDKQNII-IUCAKERBSA-N |
| XLogP | -1.01 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|