C11H22N4O4 — CID 11000252
(4S)-4-amino-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 11000252) has the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (4S)-4-amino-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11000252 |
| Molecular Formula | C11H22N4O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (4S)-4-amino-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C11H22N4O4/c12-6-2-1-3-8(10(14)18)15-11(19)7(13)4-5-9(16)17/h7-8H,1-6,12-13H2,(H2,14,18)(H,15,19)(H,16,17)/t7-,8-/m0/s1 |
| InChIKey | PEGMALXRPAOLJR-YUMQZZPRSA-N |
| XLogP | -1.72 |
| TPSA | 161.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|