C11H21N3O5 — CID 175795932
(4S)-4-amino-5-[[(2S)-6-amino-1-deuteriooxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 175795932) has the molecular formula C11H21N3O5 and a molecular weight of 276.31 g/mol. Its IUPAC name is (4S)-4-amino-5-[[(2S)-6-amino-1-deuteriooxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[(2S)-6-amino-1-deuteriooxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175795932 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (4S)-4-amino-5-[[(2S)-6-amino-1-deuteriooxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | [2H]OC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C11H21N3O5/c12-6-2-1-3-8(11(18)19)14-10(17)7(13)4-5-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1/i/hD |
| InChIKey | BBBXWRGITSUJPB-ABCRIFFVSA-N |
| XLogP | -1.12 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|