C8H14N2O4 — CID 122462104
(4R)-4-(3-aminopropanoylamino)-5-oxopentanoic acid (PubChem CID 122462104) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is (4R)-4-(3-aminopropanoylamino)-5-oxopentanoic acid.
| Compound Name | (4R)-4-(3-aminopropanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 122462104 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (4R)-4-(3-aminopropanoylamino)-5-oxopentanoic acid |
| SMILES | NCCC(=O)N[C@@H](C=O)CCC(=O)O |
| InChI | InChI=1S/C8H14N2O4/c9-4-3-7(12)10-6(5-11)1-2-8(13)14/h5-6H,1-4,9H2,(H,10,12)(H,13,14)/t6-/m1/s1 |
| InChIKey | WVAGHEQDFVZHDB-ZCFIWIBFSA-N |
| XLogP | -1.12 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|