C7H11NO4S — CID 172694165
5-oxo-4-[(2-sulfanylacetyl)amino]pentanoic acid (PubChem CID 172694165) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is 5-oxo-4-[(2-sulfanylacetyl)amino]pentanoic acid.
| Compound Name | 5-oxo-4-[(2-sulfanylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 172694165 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 5-oxo-4-[(2-sulfanylacetyl)amino]pentanoic acid |
| SMILES | O=CC(CCC(=O)O)NC(=O)CS |
| InChI | InChI=1S/C7H11NO4S/c9-3-5(1-2-7(11)12)8-6(10)4-13/h3,5,13H,1-2,4H2,(H,8,10)(H,11,12) |
| InChIKey | CCAGULWQQPCOEY-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|