C8H11NO6 — CID 173301727
4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 173301727) has the molecular formula C8H11NO6 and a molecular weight of 217.18 g/mol. Its IUPAC name is 4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 173301727 |
| Molecular Formula | C8H11NO6 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C8H11NO6/c10-4-5(3-8(14)15)9-6(11)1-2-7(12)13/h4-5H,1-3H2,(H,9,11)(H,12,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | FFBKTCBRIXNOBP-YFKPBYRVSA-N |
| XLogP | -0.99 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|