C19H29N5O11 — CID 86223077
(3S)-3-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 86223077) has the molecular formula C19H29N5O11 and a molecular weight of 503.47 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 86223077 |
| Molecular Formula | C19H29N5O11 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-4-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CN)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C19H29N5O11/c1-8(2)16(24-12(26)6-20)19(35)23-11(5-15(31)32)18(34)22-10(4-14(29)30)17(33)21-9(7-25)3-13(27)28/h7-11,16H,3-6,20H2,1-2H3,(H,21,33)(H,22,34)(H,23,35)(H,24,26)(H,27,28)(H,29,30)(H,31,32)/t9-,10-,11-,16-/m0/s1 |
| InChIKey | MZGJAJFJLNTDQS-YPIXOSSWSA-N |
| XLogP | -3.84 |
| TPSA | 271.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|