C23H37N5O10 — CID 134602775
(3S)-3-[(2-acetamido-3-methylbutanoyl)amino]-4-[[1-[[(2S)-1-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 134602775) has the molecular formula C23H37N5O10 and a molecular weight of 543.57 g/mol. Its IUPAC name is (3S)-3-[(2-acetamido-3-methylbutanoyl)amino]-4-[[1-[[(2S)-1-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[(2-acetamido-3-methylbutanoyl)amino]-4-[[1-[[(2S)-1-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134602775 |
| Molecular Formula | C23H37N5O10 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | (3S)-3-[(2-acetamido-3-methylbutanoyl)amino]-4-[[1-[[(2S)-1-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)NC(C(=O)N[C@@H](CC(=O)O)C(=O)NC(C(=O)N[C@@H](C)C(=O)N[C@H](C=O)CC(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C23H37N5O10/c1-10(2)18(25-13(6)30)23(38)27-15(8-17(33)34)21(36)28-19(11(3)4)22(37)24-12(5)20(35)26-14(9-29)7-16(31)32/h9-12,14-15,18-19H,7-8H2,1-6H3,(H,24,37)(H,25,30)(H,26,35)(H,27,38)(H,28,36)(H,31,32)(H,33,34)/t12-,14-,15-,18?,19?/m0/s1 |
| InChIKey | OOGHGBCRVSBUHH-OBBJPHKTSA-N |
| XLogP | -2.09 |
| TPSA | 237.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|