C21H30N4O12 — CID 156963229
4-[(2-acetamido-3-carboxypropanoyl)amino]-5-[[1-[(1-carboxy-3,4-dioxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 156963229) has the molecular formula C21H30N4O12 and a molecular weight of 530.49 g/mol. Its IUPAC name is 4-[(2-acetamido-3-carboxypropanoyl)amino]-5-[[1-[(1-carboxy-3,4-dioxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[(2-acetamido-3-carboxypropanoyl)amino]-5-[[1-[(1-carboxy-3,4-dioxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 156963229 |
| Molecular Formula | C21H30N4O12 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 4-[(2-acetamido-3-carboxypropanoyl)amino]-5-[[1-[(1-carboxy-3,4-dioxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(CC(=O)O)C(=O)C=O)C(C)C |
| InChI | InChI=1S/C21H30N4O12/c1-9(2)18(21(37)24-12(6-16(31)32)14(28)8-26)25-19(35)11(4-5-15(29)30)23-20(36)13(7-17(33)34)22-10(3)27/h8-9,11-13,18H,4-7H2,1-3H3,(H,22,27)(H,23,36)(H,24,37)(H,25,35)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | LUOWSNAZOQEWCS-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 262.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|