C26H42N4O11 — CID 11273293
(3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-4-oxodecanoic acid (PubChem CID 11273293) has the molecular formula C26H42N4O11 and a molecular weight of 586.64 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-4-oxodecanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-4-oxodecanoic acid |
|---|---|
| PubChem CID | 11273293 |
| Molecular Formula | C26H42N4O11 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-4-oxodecanoic acid |
| SMILES | CCCCCCC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(C)=O)C(C)C |
| InChI | InChI=1S/C26H42N4O11/c1-5-6-7-8-9-19(32)17(12-21(35)36)29-26(41)23(14(2)3)30-24(39)16(10-11-20(33)34)28-25(40)18(13-22(37)38)27-15(4)31/h14,16-18,23H,5-13H2,1-4H3,(H,27,31)(H,28,40)(H,29,41)(H,30,39)(H,33,34)(H,35,36)(H,37,38)/t16-,17-,18-,23-/m0/s1 |
| InChIKey | MKHFCYJWGWPVQU-ORQYLMBXSA-N |
| XLogP | -0.04 |
| TPSA | 245.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|