C20H30N4O11 — CID 102585972
(4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-2-carboxy-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 102585972) has the molecular formula C20H30N4O11 and a molecular weight of 502.48 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-2-carboxy-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-2-carboxy-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 102585972 |
| Molecular Formula | C20H30N4O11 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-2-carboxy-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)NC[C@@H](C=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C20H30N4O11/c1-9(2)16(19(33)21-7-11(8-25)20(34)35)24-17(31)12(4-5-14(27)28)23-18(32)13(6-15(29)30)22-10(3)26/h8-9,11-13,16H,4-7H2,1-3H3,(H,21,33)(H,22,26)(H,23,32)(H,24,31)(H,27,28)(H,29,30)(H,34,35)/t11-,12-,13-,16-/m0/s1 |
| InChIKey | CETOEGSBNKZFAD-QCQGSNGOSA-N |
| XLogP | -2.53 |
| TPSA | 245.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|