C22H30MgN4O16 — CID 87992520
magnesium bis((2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-hydroxy-5-oxopentanoate) (PubChem CID 87992520) has the molecular formula C22H30MgN4O16 and a molecular weight of 630.80 g/mol. Its IUPAC name is magnesium bis((2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-hydroxy-5-oxopentanoate).
| Compound Name | magnesium bis((2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-hydroxy-5-oxopentanoate) |
|---|---|
| PubChem CID | 87992520 |
| Molecular Formula | C22H30MgN4O16 |
| Molecular Weight | 630.80 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | magnesium bis((2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-hydroxy-5-oxopentanoate) |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)[O-].CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C11H16N2O8.Mg/c2*1-5(14)12-7(4-9(17)18)10(19)13-6(11(20)21)2-3-8(15)16;/h2*6-7H,2-4H2,1H3,(H,12,14)(H,13,19)(H,15,16)(H,17,18)(H,20,21);/q;;+2/p-2/t2*6-,7-;/m00./s1 |
| InChIKey | FOQFXVPNKDZQMP-YIPMDULYSA-L |
| XLogP | -6.25 |
| TPSA | 345.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.80 |
| LogP ≤ 5 | -6.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |