C7H13NO4 — CID 107214433
4-[[(2R)-1-hydroxypropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 107214433) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 4-[[(2R)-1-hydroxypropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R)-1-hydroxypropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107214433 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 4-[[(2R)-1-hydroxypropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](CO)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C7H13NO4/c1-5(4-9)8-6(10)2-3-7(11)12/h5,9H,2-4H2,1H3,(H,8,10)(H,11,12)/t5-/m1/s1 |
| InChIKey | ZANMIQCRENTCKD-RXMQYKEDSA-N |
| XLogP | -0.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |