C5H12N2O2 — CID 93083458
2-amino-N-[(2S)-1-hydroxypropan-2-yl]acetamide (PubChem CID 93083458) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-amino-N-[(2S)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-amino-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 93083458 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 2-amino-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@@H](CO)NC(=O)CN |
| InChI | InChI=1S/C5H12N2O2/c1-4(3-8)7-5(9)2-6/h4,8H,2-3,6H2,1H3,(H,7,9)/t4-/m0/s1 |
| InChIKey | VIXXZCBEUSYMOE-BYPYZUCNSA-N |
| XLogP | -1.56 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |