[(2S)-1-hydroxypropan-2-yl]carbamic acid

C4H9NO3 — CID 87508114

IUPAC[(2S)-1-hydroxypropan-2-yl]carbamic acid
SMILESC[C@@H](CO)NC(=O)O
InChIInChI=1S/C4H9NO3/c1-3(2-6)5-4(7)8/h3,5-6H,2H2,1H3,(H,7,8)/t3-/m0/s1
InChIKeyCZZCIUKNDIAFKX-VKHMYHEASA-N
MW119.12 g/mol
LogP-0.37
Rot. Bonds2

About [(2S)-1-hydroxypropan-2-yl]carbamic acid

[(2S)-1-hydroxypropan-2-yl]carbamic acid (PubChem CID 87508114) has the molecular formula C4H9NO3 and a molecular weight of 119.12 g/mol. Its IUPAC name is [(2S)-1-hydroxypropan-2-yl]carbamic acid.

Molecular Properties

Compound Name[(2S)-1-hydroxypropan-2-yl]carbamic acid
PubChem CID87508114
Molecular FormulaC4H9NO3
Molecular Weight119.12 g/mol
Exact Mass119.06
IUPAC Name[(2S)-1-hydroxypropan-2-yl]carbamic acid
SMILESC[C@@H](CO)NC(=O)O
InChIInChI=1S/C4H9NO3/c1-3(2-6)5-4(7)8/h3,5-6H,2H2,1H3,(H,7,8)/t3-/m0/s1
InChIKeyCZZCIUKNDIAFKX-VKHMYHEASA-N
XLogP-0.37
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500119.12
LogP ≤ 5-0.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(2S)-1-hydroxypropan-2-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2S)-1-hydroxypropan-2-yl]carbamic acid?
The IUPAC name of [(2S)-1-hydroxypropan-2-yl]carbamic acid (CID 87508114) is [(2S)-1-hydroxypropan-2-yl]carbamic acid.
What is the SMILES notation for [(2S)-1-hydroxypropan-2-yl]carbamic acid?
The canonical SMILES for [(2S)-1-hydroxypropan-2-yl]carbamic acid is C[C@@H](CO)NC(=O)O.
What is the InChIKey of [(2S)-1-hydroxypropan-2-yl]carbamic acid?
The InChIKey is CZZCIUKNDIAFKX-VKHMYHEASA-N. The full InChI is InChI=1S/C4H9NO3/c1-3(2-6)5-4(7)8/h3,5-6H,2H2,1H3,(H,7,8)/t3-/m0/s1.
What are the key properties of [(2S)-1-hydroxypropan-2-yl]carbamic acid?
[(2S)-1-hydroxypropan-2-yl]carbamic acid has a molecular weight of 119.12 g/mol, XLogP of -0.37, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-hydroxypropan-2-yl]carbamic acid is sourced from PubChem (CID 87508114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).