C5H12N2O3 — CID 65314479
2-amino-N-(1,3-dihydroxypropan-2-yl)acetamide (PubChem CID 65314479) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-amino-N-(1,3-dihydroxypropan-2-yl)acetamide.
| Compound Name | 2-amino-N-(1,3-dihydroxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 65314479 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 2-amino-N-(1,3-dihydroxypropan-2-yl)acetamide |
| SMILES | NCC(=O)NC(CO)CO |
| InChI | InChI=1S/C5H12N2O3/c6-1-5(10)7-4(2-8)3-9/h4,8-9H,1-3,6H2,(H,7,10) |
| InChIKey | ASTQQMNJQTURPA-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |