C6H12N2O4 — CID 61244410
2-[(2-aminoacetyl)amino]-4-hydroxybutanoic acid (PubChem CID 61244410) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(2-aminoacetyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61244410 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-4-hydroxybutanoic acid |
| SMILES | NCC(=O)NC(CCO)C(=O)O |
| InChI | InChI=1S/C6H12N2O4/c7-3-5(10)8-4(1-2-9)6(11)12/h4,9H,1-3,7H2,(H,8,10)(H,11,12) |
| InChIKey | FNVZKKVFPAYKQB-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |