C7H10F3NO4 — CID 107822678
(2R)-4-hydroxy-2-(3,3,3-trifluoropropanoylamino)butanoic acid (PubChem CID 107822678) has the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-(3,3,3-trifluoropropanoylamino)butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-(3,3,3-trifluoropropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 107822678 |
| Molecular Formula | C7H10F3NO4 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | (2R)-4-hydroxy-2-(3,3,3-trifluoropropanoylamino)butanoic acid |
| SMILES | O=C(CC(F)(F)F)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C7H10F3NO4/c8-7(9,10)3-5(13)11-4(1-2-12)6(14)15/h4,12H,1-3H2,(H,11,13)(H,14,15)/t4-/m1/s1 |
| InChIKey | IAWRZDIHOKXLFH-SCSAIBSYSA-N |
| XLogP | -0.11 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |