C8H12F3NO4 — CID 107823042
(2R)-4-hydroxy-2-(4,4,4-trifluorobutanoylamino)butanoic acid (PubChem CID 107823042) has the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-(4,4,4-trifluorobutanoylamino)butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-(4,4,4-trifluorobutanoylamino)butanoic acid |
|---|---|
| PubChem CID | 107823042 |
| Molecular Formula | C8H12F3NO4 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2R)-4-hydroxy-2-(4,4,4-trifluorobutanoylamino)butanoic acid |
| SMILES | O=C(CCC(F)(F)F)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C8H12F3NO4/c9-8(10,11)3-1-6(14)12-5(2-4-13)7(15)16/h5,13H,1-4H2,(H,12,14)(H,15,16)/t5-/m1/s1 |
| InChIKey | KAZHFHFZLZNVNB-RXMQYKEDSA-N |
| XLogP | 0.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |