C9H15F2NO5 — CID 107822809
(2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-hydroxybutanoic acid (PubChem CID 107822809) has the molecular formula C9H15F2NO5 and a molecular weight of 255.22 g/mol. Its IUPAC name is (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107822809 |
| Molecular Formula | C9H15F2NO5 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(CCOCC(F)F)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C9H15F2NO5/c10-7(11)5-17-4-2-8(14)12-6(1-3-13)9(15)16/h6-7,13H,1-5H2,(H,12,14)(H,15,16)/t6-/m1/s1 |
| InChIKey | HGMIWWFLYPDJDO-ZCFIWIBFSA-N |
| XLogP | -0.39 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|