C11H19NO5 — CID 91574406
(2S)-4-hydroxy-2-(7-oxoheptanoylamino)butanoic acid (PubChem CID 91574406) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(7-oxoheptanoylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-(7-oxoheptanoylamino)butanoic acid |
|---|---|
| PubChem CID | 91574406 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (2S)-4-hydroxy-2-(7-oxoheptanoylamino)butanoic acid |
| SMILES | O=CCCCCCC(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C11H19NO5/c13-7-4-2-1-3-5-10(15)12-9(6-8-14)11(16)17/h7,9,14H,1-6,8H2,(H,12,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | NRAFMPLXAJXFRX-VIFPVBQESA-N |
| XLogP | 0.09 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|