C15H25NO6 — CID 89058879
2-[[(Z)-11-hydroxyundec-8-enoyl]amino]butanedioic acid (PubChem CID 89058879) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[[(Z)-11-hydroxyundec-8-enoyl]amino]butanedioic acid.
| Compound Name | 2-[[(Z)-11-hydroxyundec-8-enoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 89058879 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-[[(Z)-11-hydroxyundec-8-enoyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)CCCCCC/C=C\CCO)C(=O)O |
| InChI | InChI=1S/C15H25NO6/c17-10-8-6-4-2-1-3-5-7-9-13(18)16-12(15(21)22)11-14(19)20/h4,6,12,17H,1-3,5,7-11H2,(H,16,18)(H,19,20)(H,21,22)/b6-4- |
| InChIKey | QUMRNMQSHPMHDG-XQRVVYSFSA-N |
| XLogP | 1.31 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|