C16H30KNO5 — CID 174413671
potassium;(2S)-2-(dodecanoylamino)butanedioic acid;hydride (PubChem CID 174413671) has the molecular formula C16H30KNO5 and a molecular weight of 355.52 g/mol. Its IUPAC name is potassium;(2S)-2-(dodecanoylamino)butanedioic acid;hydride.
| Compound Name | potassium;(2S)-2-(dodecanoylamino)butanedioic acid;hydride |
|---|---|
| PubChem CID | 174413671 |
| Molecular Formula | C16H30KNO5 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | potassium;(2S)-2-(dodecanoylamino)butanedioic acid;hydride |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CC(=O)O)C(=O)O.[H-].[K+] |
| InChI | InChI=1S/C16H29NO5.K.H/c1-2-3-4-5-6-7-8-9-10-11-14(18)17-13(16(21)22)12-15(19)20;;/h13H,2-12H2,1H3,(H,17,18)(H,19,20)(H,21,22);;/q;+1;-1/t13-;;/m0../s1 |
| InChIKey | UUOSPOCZQLAWII-GXKRWWSZSA-N |
| XLogP | 0.07 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|