C18H34KNO5 — CID 175453509
potassium;hydride;2-(tetradecanoylamino)butanedioic acid (PubChem CID 175453509) has the molecular formula C18H34KNO5 and a molecular weight of 383.57 g/mol. Its IUPAC name is potassium;hydride;2-(tetradecanoylamino)butanedioic acid.
| Compound Name | potassium;hydride;2-(tetradecanoylamino)butanedioic acid |
|---|---|
| PubChem CID | 175453509 |
| Molecular Formula | C18H34KNO5 |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | potassium;hydride;2-(tetradecanoylamino)butanedioic acid |
| SMILES | CCCCCCCCCCCCCC(=O)NC(CC(=O)O)C(=O)O.[H-].[K+] |
| InChI | InChI=1S/C18H33NO5.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(20)19-15(18(23)24)14-17(21)22;;/h15H,2-14H2,1H3,(H,19,20)(H,21,22)(H,23,24);;/q;+1;-1 |
| InChIKey | GDROMULELAYTSL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|