C24H48N2O8 — CID 87169965
2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)butanedioic acid (PubChem CID 87169965) has the molecular formula C24H48N2O8 and a molecular weight of 492.65 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)butanedioic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)butanedioic acid |
|---|---|
| PubChem CID | 87169965 |
| Molecular Formula | C24H48N2O8 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)butanedioic acid |
| SMILES | CCCCCCCCCCCCCC(=O)N[C@@H](CC(=O)O)C(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C18H33NO5.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(20)19-15(18(23)24)14-17(21)22;8-4-1-7(2-5-9)3-6-10/h15H,2-14H2,1H3,(H,19,20)(H,21,22)(H,23,24);8-10H,1-6H2/t15-;/m0./s1 |
| InChIKey | KHDANWFKILAGPO-RSAXXLAASA-N |
| XLogP | 2.00 |
| TPSA | 167.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|