C10H19NNa2O5 — CID 174918684
disodium;(2S)-2-(hexanoylamino)butanedioic acid;hydride (PubChem CID 174918684) has the molecular formula C10H19NNa2O5 and a molecular weight of 279.24 g/mol. Its IUPAC name is disodium;(2S)-2-(hexanoylamino)butanedioic acid;hydride.
| Compound Name | disodium;(2S)-2-(hexanoylamino)butanedioic acid;hydride |
|---|---|
| PubChem CID | 174918684 |
| Molecular Formula | C10H19NNa2O5 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | disodium;(2S)-2-(hexanoylamino)butanedioic acid;hydride |
| SMILES | CCCCCC(=O)N[C@@H](CC(=O)O)C(=O)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C10H17NO5.2Na.2H/c1-2-3-4-5-8(12)11-7(10(15)16)6-9(13)14;;;;/h7H,2-6H2,1H3,(H,11,12)(H,13,14)(H,15,16);;;;/q;2*+1;2*-1/t7-;;;;/m0..../s1 |
| InChIKey | WTAUNWVNHBQGPQ-HEDVWWMMSA-N |
| XLogP | -5.16 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|