C8H13NO5Zn — CID 174973870
2-(butanoylamino)butanedioic acid;zinc (PubChem CID 174973870) has the molecular formula C8H13NO5Zn and a molecular weight of 268.58 g/mol. Its IUPAC name is 2-(butanoylamino)butanedioic acid;zinc.
| Compound Name | 2-(butanoylamino)butanedioic acid;zinc |
|---|---|
| PubChem CID | 174973870 |
| Molecular Formula | C8H13NO5Zn |
| Molecular Weight | 268.58 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 2-(butanoylamino)butanedioic acid;zinc |
| SMILES | CCCC(=O)NC(CC(=O)O)C(=O)O.[Zn] |
| InChI | InChI=1S/C8H13NO5.Zn/c1-2-3-6(10)9-5(8(13)14)4-7(11)12;/h5H,2-4H2,1H3,(H,9,10)(H,11,12)(H,13,14); |
| InChIKey | RDJXHWZWIXSJCF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.58 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|