C9H17NO3Se — CID 89313972
(2S)-2-(butanoylamino)-4-methylselanylbutanoic acid (PubChem CID 89313972) has the molecular formula C9H17NO3Se and a molecular weight of 266.20 g/mol. Its IUPAC name is (2S)-2-(butanoylamino)-4-methylselanylbutanoic acid.
| Compound Name | (2S)-2-(butanoylamino)-4-methylselanylbutanoic acid |
|---|---|
| PubChem CID | 89313972 |
| Molecular Formula | C9H17NO3Se |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | (2S)-2-(butanoylamino)-4-methylselanylbutanoic acid |
| SMILES | CCCC(=O)N[C@@H](CC[Se]C)C(=O)O |
| InChI | InChI=1S/C9H17NO3Se/c1-3-4-8(11)10-7(9(12)13)5-6-14-2/h7H,3-6H2,1-2H3,(H,10,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | MAAQOLHQJYXEDR-ZETCQYMHSA-N |
| XLogP | 0.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|