C5H11NO3Se — CID 87429227
(2S)-2-(hydroxyamino)-4-methylselanylbutanoic acid (PubChem CID 87429227) has the molecular formula C5H11NO3Se and a molecular weight of 212.11 g/mol. Its IUPAC name is (2S)-2-(hydroxyamino)-4-methylselanylbutanoic acid.
| Compound Name | (2S)-2-(hydroxyamino)-4-methylselanylbutanoic acid |
|---|---|
| PubChem CID | 87429227 |
| Molecular Formula | C5H11NO3Se |
| Molecular Weight | 212.11 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | (2S)-2-(hydroxyamino)-4-methylselanylbutanoic acid |
| SMILES | C[Se]CC[C@H](NO)C(=O)O |
| InChI | InChI=1S/C5H11NO3Se/c1-10-3-2-4(6-9)5(7)8/h4,6,9H,2-3H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | KXIGXGAUZXFZHG-BYPYZUCNSA-N |
| XLogP | -0.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.11 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|