C25H48N2O11Se2 — CID 159182917
(2S)-2-amino-4-methylselanylbutanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid (PubChem CID 159182917) has the molecular formula C25H48N2O11Se2 and a molecular weight of 710.58 g/mol. Its IUPAC name is (2S)-2-amino-4-methylselanylbutanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid.
| Compound Name | (2S)-2-amino-4-methylselanylbutanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid |
|---|---|
| PubChem CID | 159182917 |
| Molecular Formula | C25H48N2O11Se2 |
| Molecular Weight | 710.58 g/mol |
| Exact Mass | 712.16 |
| IUPAC Name | (2S)-2-amino-4-methylselanylbutanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.C[Se]CC[C@H](N)C(=O)O.C[Se]CC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H19NO4Se.C10H18O5.C5H11NO2Se/c1-10(2,3)15-9(14)11-7(8(12)13)5-6-16-4;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-9-3-2-4(6)5(7)8/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13);1-6H3;4H,2-3,6H2,1H3,(H,7,8)/t7-;;4-/m0.0/s1 |
| InChIKey | KNCXJRVOADWKCP-CWKCZKLGSA-N |
| XLogP | 4.36 |
| TPSA | 200.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|