C5H11NO4S — CID 172552891
(2S)-2-(hydroxyamino)-4-methylsulfinylbutanoic acid (PubChem CID 172552891) has the molecular formula C5H11NO4S and a molecular weight of 181.21 g/mol. Its IUPAC name is (2S)-2-(hydroxyamino)-4-methylsulfinylbutanoic acid.
| Compound Name | (2S)-2-(hydroxyamino)-4-methylsulfinylbutanoic acid |
|---|---|
| PubChem CID | 172552891 |
| Molecular Formula | C5H11NO4S |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | (2S)-2-(hydroxyamino)-4-methylsulfinylbutanoic acid |
| SMILES | CS(=O)CC[C@H](NO)C(=O)O |
| InChI | InChI=1S/C5H11NO4S/c1-11(10)3-2-4(6-9)5(7)8/h4,6,9H,2-3H2,1H3,(H,7,8)/t4-,11?/m0/s1 |
| InChIKey | CVRCOCOPWJZBLX-DPVSGNNYSA-N |
| XLogP | -0.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|