C8H17NO2S2 — CID 107035623
N-(4-methylsulfinylbutan-2-yl)-3-sulfanylpropanamide (PubChem CID 107035623) has the molecular formula C8H17NO2S2 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-(4-methylsulfinylbutan-2-yl)-3-sulfanylpropanamide.
| Compound Name | N-(4-methylsulfinylbutan-2-yl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107035623 |
| Molecular Formula | C8H17NO2S2 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | N-(4-methylsulfinylbutan-2-yl)-3-sulfanylpropanamide |
| SMILES | CC(CCS(C)=O)NC(=O)CCS |
| InChI | InChI=1S/C8H17NO2S2/c1-7(4-6-13(2)11)9-8(10)3-5-12/h7,12H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | CLRGACGGSVMENM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|