C8H16N2O4S2 — CID 91746292
2-[(2-amino-4-methylsulfinylbutanoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 91746292) has the molecular formula C8H16N2O4S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[(2-amino-4-methylsulfinylbutanoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2-amino-4-methylsulfinylbutanoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 91746292 |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-[(2-amino-4-methylsulfinylbutanoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CS(=O)CCC(N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S2/c1-16(14)3-2-5(9)7(11)10-6(4-15)8(12)13/h5-6,15H,2-4,9H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | ALIIKNOKPRXIHH-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|