About 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid
2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid (PubChem CID 73440789) has the molecular formula C7H18N2O3Se
and a molecular weight of 257.19 g/mol. Its IUPAC name is 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid.
Molecular Properties
| Compound Name | 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid |
| PubChem CID | 73440789 |
| Molecular Formula | C7H18N2O3Se |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid |
| SMILES | C[Se]CC[C@H](N)C(=O)O.NCCO |
| InChI | InChI=1S/C5H11NO2Se.C2H7NO/c1-9-3-2-4(6)5(7)8;3-1-2-4/h4H,2-3,6H2,1H3,(H,7,8);4H,1-3H2/t4-;/m0./s1 |
| InChIKey | QZPFVVTZRBDKKX-WCCKRBBISA-N |
| XLogP | -1.10 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
The IUPAC name of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid (CID 73440789) is 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid.
What is the SMILES notation for 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
The canonical SMILES for 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid is C[Se]CC[C@H](N)C(=O)O.NCCO.
What is the InChIKey of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
The InChIKey is QZPFVVTZRBDKKX-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2Se.C2H7NO/c1-9-3-2-4(6)5(7)8;3-1-2-4/h4H,2-3,6H2,1H3,(H,7,8);4H,1-3H2/t4-;/m0./s1.
What are the key properties of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid has a molecular weight of 257.19 g/mol, XLogP of -1.10, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid is sourced from PubChem (CID 73440789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).