2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid

C7H18N2O3Se — CID 73440789

IUPAC2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid
SMILESC[Se]CC[C@H](N)C(=O)O.NCCO
InChIInChI=1S/C5H11NO2Se.C2H7NO/c1-9-3-2-4(6)5(7)8;3-1-2-4/h4H,2-3,6H2,1H3,(H,7,8);4H,1-3H2/t4-;/m0./s1
InChIKeyQZPFVVTZRBDKKX-WCCKRBBISA-N
MW257.19 g/mol
LogP-1.10
Rot. Bonds5

About 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid

2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid (PubChem CID 73440789) has the molecular formula C7H18N2O3Se and a molecular weight of 257.19 g/mol. Its IUPAC name is 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid.

Molecular Properties

Compound Name2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid
PubChem CID73440789
Molecular FormulaC7H18N2O3Se
Molecular Weight257.19 g/mol
Exact Mass258.05
IUPAC Name2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid
SMILESC[Se]CC[C@H](N)C(=O)O.NCCO
InChIInChI=1S/C5H11NO2Se.C2H7NO/c1-9-3-2-4(6)5(7)8;3-1-2-4/h4H,2-3,6H2,1H3,(H,7,8);4H,1-3H2/t4-;/m0./s1
InChIKeyQZPFVVTZRBDKKX-WCCKRBBISA-N
XLogP-1.10
TPSA109.57 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.19
LogP ≤ 5-1.10
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
The IUPAC name of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid (CID 73440789) is 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid.
What is the SMILES notation for 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
The canonical SMILES for 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid is C[Se]CC[C@H](N)C(=O)O.NCCO.
What is the InChIKey of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
The InChIKey is QZPFVVTZRBDKKX-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2Se.C2H7NO/c1-9-3-2-4(6)5(7)8;3-1-2-4/h4H,2-3,6H2,1H3,(H,7,8);4H,1-3H2/t4-;/m0./s1.
What are the key properties of 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid?
2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid has a molecular weight of 257.19 g/mol, XLogP of -1.10, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;(2S)-2-amino-4-methylselanylbutanoic acid is sourced from PubChem (CID 73440789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).