C5H12N2O2Se — CID 71381711
(2S)-2-amino-N-hydroxy-4-methylselanylbutanamide (PubChem CID 71381711) has the molecular formula C5H12N2O2Se and a molecular weight of 211.12 g/mol. Its IUPAC name is (2S)-2-amino-N-hydroxy-4-methylselanylbutanamide.
| Compound Name | (2S)-2-amino-N-hydroxy-4-methylselanylbutanamide |
|---|---|
| PubChem CID | 71381711 |
| Molecular Formula | C5H12N2O2Se |
| Molecular Weight | 211.12 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | (2S)-2-amino-N-hydroxy-4-methylselanylbutanamide |
| SMILES | C[Se]CC[C@H](N)C(=O)NO |
| InChI | InChI=1S/C5H12N2O2Se/c1-10-3-2-4(6)5(8)7-9/h4,9H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | BXMYSZGGJPNJME-BYPYZUCNSA-N |
| XLogP | -0.62 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.12 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|