C6H14N2O2 — CID 6951121
(2R)-2-amino-N-hydroxy-4-methylpentanamide (PubChem CID 6951121) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2R)-2-amino-N-hydroxy-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 6951121 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (2R)-2-amino-N-hydroxy-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)NO |
| InChI | InChI=1S/C6H14N2O2/c1-4(2)3-5(7)6(9)8-10/h4-5,10H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | UJJHPFLWSVFLBE-RXMQYKEDSA-N |
| XLogP | -0.13 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|