C12H24N2O2 — CID 57076326
(4S,7S)-4,7-diamino-2,9-dimethyldecane-5,6-dione (PubChem CID 57076326) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (4S,7S)-4,7-diamino-2,9-dimethyldecane-5,6-dione.
| Compound Name | (4S,7S)-4,7-diamino-2,9-dimethyldecane-5,6-dione |
|---|---|
| PubChem CID | 57076326 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (4S,7S)-4,7-diamino-2,9-dimethyldecane-5,6-dione |
| SMILES | CC(C)C[C@H](N)C(=O)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-7(2)5-9(13)11(15)12(16)10(14)6-8(3)4/h7-10H,5-6,13-14H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | MTGGBINGLVUFRN-UWVGGRQHSA-N |
| XLogP | 0.87 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|