C12H27N5O2 — CID 122418789
(4S,7S)-4,7-diamino-1-(diaminomethylamino)-9-methyldecane-5,6-dione (PubChem CID 122418789) has the molecular formula C12H27N5O2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (4S,7S)-4,7-diamino-1-(diaminomethylamino)-9-methyldecane-5,6-dione.
| Compound Name | (4S,7S)-4,7-diamino-1-(diaminomethylamino)-9-methyldecane-5,6-dione |
|---|---|
| PubChem CID | 122418789 |
| Molecular Formula | C12H27N5O2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | (4S,7S)-4,7-diamino-1-(diaminomethylamino)-9-methyldecane-5,6-dione |
| SMILES | CC(C)C[C@H](N)C(=O)C(=O)[C@@H](N)CCCNC(N)N |
| InChI | InChI=1S/C12H27N5O2/c1-7(2)6-9(14)11(19)10(18)8(13)4-3-5-17-12(15)16/h7-9,12,17H,3-6,13-16H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | QFZPPIIXBDXXHU-IUCAKERBSA-N |
| XLogP | -1.60 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|