C11H24N4O3 — CID 118228805
tert-butyl (3S)-3-amino-6-(diaminomethylamino)-2-oxohexanoate (PubChem CID 118228805) has the molecular formula C11H24N4O3 and a molecular weight of 260.34 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-6-(diaminomethylamino)-2-oxohexanoate.
| Compound Name | tert-butyl (3S)-3-amino-6-(diaminomethylamino)-2-oxohexanoate |
|---|---|
| PubChem CID | 118228805 |
| Molecular Formula | C11H24N4O3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | tert-butyl (3S)-3-amino-6-(diaminomethylamino)-2-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)[C@@H](N)CCCNC(N)N |
| InChI | InChI=1S/C11H24N4O3/c1-11(2,3)18-9(17)8(16)7(12)5-4-6-15-10(13)14/h7,10,15H,4-6,12-14H2,1-3H3/t7-/m0/s1 |
| InChIKey | PWIJXGXBMKAPKO-ZETCQYMHSA-N |
| XLogP | -1.20 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|