C10H17NO5 — CID 57090441
(4S)-4-amino-6-[(2-methylpropan-2-yl)oxy]-5,6-dioxohexanoic acid (PubChem CID 57090441) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (4S)-4-amino-6-[(2-methylpropan-2-yl)oxy]-5,6-dioxohexanoic acid.
| Compound Name | (4S)-4-amino-6-[(2-methylpropan-2-yl)oxy]-5,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 57090441 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (4S)-4-amino-6-[(2-methylpropan-2-yl)oxy]-5,6-dioxohexanoic acid |
| SMILES | CC(C)(C)OC(=O)C(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C10H17NO5/c1-10(2,3)16-9(15)8(14)6(11)4-5-7(12)13/h6H,4-5,11H2,1-3H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | SYAOUXYNIUNPLL-LURJTMIESA-N |
| XLogP | 0.09 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|