C9H20N4O2 — CID 89257101
(5S)-5-amino-8-(diaminomethylamino)octane-2,4-dione (PubChem CID 89257101) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (5S)-5-amino-8-(diaminomethylamino)octane-2,4-dione.
| Compound Name | (5S)-5-amino-8-(diaminomethylamino)octane-2,4-dione |
|---|---|
| PubChem CID | 89257101 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (5S)-5-amino-8-(diaminomethylamino)octane-2,4-dione |
| SMILES | CC(=O)CC(=O)[C@@H](N)CCCNC(N)N |
| InChI | InChI=1S/C9H20N4O2/c1-6(14)5-8(15)7(10)3-2-4-13-9(11)12/h7,9,13H,2-5,10-12H2,1H3/t7-/m0/s1 |
| InChIKey | NOZSGICMVHWJRC-ZETCQYMHSA-N |
| XLogP | -1.57 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|