C6H15N3O3 — CID 118054974
(2S)-2-amino-5-[[amino(hydroxy)methyl]amino]pentanoic acid (PubChem CID 118054974) has the molecular formula C6H15N3O3 and a molecular weight of 177.20 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino(hydroxy)methyl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[amino(hydroxy)methyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 118054974 |
| Molecular Formula | C6H15N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | (2S)-2-amino-5-[[amino(hydroxy)methyl]amino]pentanoic acid |
| SMILES | NC(O)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H15N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4,6,9,12H,1-3,7-8H2,(H,10,11)/t4-,6?/m0/s1 |
| InChIKey | AMEYCIFSOHYXKZ-VKZKZBKNSA-N |
| XLogP | -2.00 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|